 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 35Ethyl Methacrylate |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-11-26 08:29 |
| |
 |
|
Ethyl Methacrylate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
97-63-2 |
| EC NO: |
202-597-5 |
| Molecular Formula: |
C7H12O2
|
| Molecular Weight: |
128.169 |
| Specification: |
|
| InChI: |
InChI=1/C7H12O2/c1-4-6(3)7(8)9-5-2/h3-5H2,1-2H3 |
| Synonyms: |
2-Methyl-2-Propenoic Acid Ethyl Ester;ethyl 2-methyl-2-propenoate;ethyl alpha-methylacrylate;Methacrylic Acid Ethyl Ester;Rhoplex ac-33;2-methyl-2-propenoicacid,ethylester;2-methyl-2-propenoicaciethylester;2-Methylacrylic acid, ethyl ester;2-methyl-prop-2-enoicacidethylester;2-Propenoicacid,2-methyl-,ethylester;EMA;Ethyl 2-methacrylate;ethyl 2-methylidenebutanoate; |
| Molecular Structure: |
 |
|
